| Name |
Punigluconin |
| Formula |
C34H26O23 |
| Mw |
802.08648714 |
| CAS RN |
103488-38-6 |
| C_ID |
C00053729
|
| InChIKey |
LXDFURPXDYWVDX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C34H26O23/c35-12-1-8(2-13(36)21(12)41)31(50)55-18-7-54-33(52)10-5-16(39)23(43)25(45)19(10)20-11(6-17(40)24(44)26(20)46)34(53)56-28(18)27(47)29(30(48)49)57-32(51)9-3-14(37)22(42)15(38)4-9/h1-6,18,27-29,35-47H,7H2,(H,48,49) |
| SMILES |
O=C(OC1COC(=O)c2cc(O)c(O)c(O)c2-c2c(cc(O)c(O)c2O)C(=O)OC1C(O)C(OC(=O)c1cc(O)c(O)c(O)c1)C(=O)O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus niruri  | Ref. |
|
|
zoom in
| Organism | Phyllanthus niruri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|