| Name |
p-Methoxycinnamic acid |
| Formula |
C10H10O3 |
| Mw |
178.06299419 |
| CAS RN |
830-09-1 |
| C_ID |
C00051715
|
| InChIKey |
HPDXQTSWFBYAQF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| SMILES |
COc1ccc(C=COC=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|