| Name |
Methyl myristate Myristic acid, methyl ester Methyl tetradecanoate |
| Formula |
C15H30O2 |
| Mw |
242.2245802 |
| CAS RN |
124-10-7 |
| C_ID |
C00051572
|
| InChIKey |
ZAZKJZBWRNNLDS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
| SMILES |
CCCCCCCCCCCCCC(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Codonopsis pilosula | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Fan, et al., Zhongyao Tongbao, 11, (1986), 556 |
|---|
|