| Name |
N-Methylpelletierine
Methylisopelletierine |
| Formula |
C9H17NO |
| Mw |
155.13101417 |
| CAS RN |
18747-42-7 |
| C_ID |
C00051563
|
| InChIKey |
TYHJMEIBGDDCPA-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C9H17NO/c1-8(11)7-9-5-3-4-6-10(9)2/h9H,3-7H2,1-2H3/t9-/m0/s1 |
| SMILES |
CC(=O)CC1CCCCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum acre  | Ref. |
| Plantae | Crassulaceae | Sedum kamtschaticum | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Solanaceae | Withania somnifera | Ref. |
|
|
zoom in
| Organism | Sedum sarmentosum |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Krasnov, et al., Chem Abstr, 87, (1977), 164249k.
Marion, et al., Can J Research(B), 27, (1949), 215.
Lin, Zhongcaoyao Chengfen Huaxue, First edition, Science Press, Beijing, (1977), 704.
Nanba, et al., Introduction of Pharmacognosy(Japan), (1990), 263 |
|---|
|
