| Name |
Kaurene Kaurane ent-Kaurane |
| Formula |
C20H34 |
| Mw |
274.26605108 |
| CAS RN |
1573-40-6 |
| C_ID |
C00051134
|
| InChIKey |
IVZWRQBQDVHDNG-ZZKCWRQDNA-N |
| InChICode |
InChI=1S/C20H34/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h14-17H,5-13H2,1-4H3/t14-,15+,16+,17-,19+,20+/m0/s1 |
| SMILES |
C[C@H]1C[C@@]23CC[C@@H]4C(C)(C)CCC[C@@]4(C)[C@@H]2CC[C@@H]1C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia triangularis | Ref. |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Fabaceae | Copaifera langsdorffii  | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Podocarpaceae | Podocarpus macrophyllus  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria fortunei | Ref. |
|
|
zoom in
| Organism | Stellaria pallida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|