| Name |
Isopulegone |
| Formula |
C10H16O |
| Mw |
152.12011513 |
| CAS RN |
29606-79-9 |
| C_ID |
C00050985
|
| InChIKey |
RMIANEGNSBUGDJ-BRJQIKQINA-N |
| InChICode |
InChI=1/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-9H,1,4-6H2,2-3H3/t8-,9+/s2 |
| SMILES |
C=C(C)[C@@H]1CC[C@@H](C)CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
|
|
zoom in
| Organism | Schizonepeta tenuifolia | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|