| Name |
Isochesnatin |
| Formula |
C27H26O18 |
| Mw |
638.11191403 |
| CAS RN |
115356-00-8 |
| C_ID |
C00050887
|
| InChIKey |
HHHTYMMYVSGADO-URDJBTPVNA-N |
| InChICode |
InChI=1S/C27H26O18/c28-6-16-19(35)20(36)22(38)27(44-16)45-24-13(31)1-8(2-14(24)32)7-42-26(41)9-3-11(29)17(33)15(4-9)43-23-10(25(39)40)5-12(30)18(34)21(23)37/h1-5,16,19-20,22,27-38H,6-7H2,(H,39,40)/t16-,19-,20+,22-,27+/m1/s1 |
| SMILES |
O=COc1cc(O)c(O)c(O)c1Oc1cc(C(=O)OCc2cc(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c2)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fagaceae | Castanea mollissima  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Rosaceae | Pyrus bretschneideri  | Ref. |
|
|
zoom in
| Organism | Pyrus bretschneideri | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|