| Name |
Isobutylshikonin Isobutyryl shikonin |
| Formula |
C20H22O6 |
| Mw |
358.14163844 |
| CAS RN |
52438-12-7 |
| C_ID |
C00050883
|
| InChIKey |
BVRYLTBIGIAADD-XISACWJONA-N |
| InChICode |
InChI=1S/C20H22O6/c1-10(2)5-8-16(26-20(25)11(3)4)12-9-15(23)17-13(21)6-7-14(22)18(17)19(12)24/h5-7,9,11,16,21-22H,8H2,1-4H3/t16-/m1/s1 |
| SMILES |
CC(C)=CC[C@@H](OC(=O)C(C)C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Boraginaceae | Lithospermum viridiflorum | Ref. |
|
|
zoom in
| Organism | Lithospermum viridiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|