| Name |
Inflacoumarin A |
| Formula |
C20H18O4 |
| Mw |
322.12050906 |
| CAS RN |
158446-33-4 |
| C_ID |
C00050825
|
| InChIKey |
RNBLSJGPSGNSIN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O4/c1-12(2)3-4-14-9-17-16(13-5-7-15(21)8-6-13)10-20(23)24-19(17)11-18(14)22/h3,5-11,21-22H,4H2,1-2H3 |
| SMILES |
CC(C)=CCc1cc2c(-c3ccc(O)cc3)cc(=O)oc2cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|