| Name |
Convallamarin |
| Formula |
C44H70O19 |
| Mw |
902.45113006 |
| CAS RN |
1391-12-4 |
| C_ID |
C00050564
|
| InChIKey |
YIVJHIINQZUPTD-JZJUYLCRSA-N |
| InChICode |
InChI=1S/C30H28O11/c1-14-9-17-11-19(12-21(33)25(17)29-24(14)20(32)10-15(2)39-29)40-30-28(37)27(36)26(35)22(41-30)13-38-23(34)8-5-16-3-6-18(31)7-4-16/h3-12,22,26-28,30-31,33,35-37H,13H2,1-2H3/b8-5+/t22-,26-,27+,28-,30-/m1/s1 |
| SMILES |
C=C(CC[C@@]1(O)O[C@H]2C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](C)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H]6O)C[C@@H](O[C@@H]6O[C@H](C)[C@@H](O[C@@H]7O[C@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@@H](O)[C@H]6O)[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1C)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convallariaceae | Convallaria keiskei  | Ref. |
| Plantae | Convallariaceae | Convallaria majalis  | Ref. |
| Plantae | Convallariaceae | Polygonatum odoratum  | Ref. |
|
|
zoom in
| Organism | Polygonatum odoratum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|