| Name |
Phaeophorbide a Pheophorbide A |
| Formula |
C35H36N4O5 |
| Mw |
592.26857029 |
| CAS RN |
15664-29-6 |
| C_ID |
C00048505
, 
|
| InChIKey |
NSFSLUUZQIAOOX-YSKGJVQYNA-N |
| InChICode |
InChI=1S/C35H36N4O5/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22/h8,12-14,17,21,31,36,39H,1,9-11H2,2-7H3,(H,40,41)/b22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-/t17-,21-,31+/m0/s1 |
| SMILES |
C=Cc1c(C)c2cc3nc(c4c5[nH]c(cc6nc(cc1[nH]2)C(C)=C6CC)c(C)c5C(=O)[C@@H]4C(=O)OC)[C@@H](CCC(=O)O)[C@@H]3C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
|
|
zoom in
| Organism | Morinda citrifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|