| Name |
7-epi-alpha-Selinene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
123123-37-5 |
| C_ID |
C00048297
, 
|
| InChIKey |
OZQAPQSEYFAMCY-OSLIHGISNA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14-,15+/m0/s1 |
| SMILES |
C=C(C)[C@H]1CC[C@@]2(C)CCC=C(C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Primula halleri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|