| Name |
Methyl-beta-orcinol carboxylate |
| Formula |
C10H14O2 |
| Mw |
166.09937969 |
| CAS RN |
21390-25-0 |
| C_ID |
C00046823
, 
|
| InChIKey |
GIUXLBFXMAOOQJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H14O2/c1-7-5-9(11-3)8(2)10(6-7)12-4/h5-6H,1-4H3 |
| SMILES |
COc1cc(C)cc(OC)c1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Umbilicariaceae | Umbilicaria hypococcinea | Ref. |
| Plantae | Amaranthaceae | Amaranthus hypochondriacus  | Ref. |
| - | - | Lethariella cladonioides | Ref. |
| - | - | Lethariella zahlbruckneri | Ref. |
|
|
zoom in
| Organism | Lethariella cladonioides | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sun, et al., Zhiwu Xuebao, 32, (1990), 783 |
|---|
|