| Name |
Oxychelerythrine |
| Formula |
C21H17NO5 |
| Mw |
363.11067266 |
| CAS RN |
28342-33-8 |
| C_ID |
C00044274
, 
|
| InChIKey |
IHTXRYTWDARUKX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H17NO5/c1-22-19-13(5-4-11-8-16-17(9-14(11)19)27-10-26-16)12-6-7-15(24-2)20(25-3)18(12)21(22)23/h4-9H,10H2,1-3H3 |
| SMILES |
COc1ccc2c(c1OC)c(=O)n(C)c1c3cc4c(cc3ccc21)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Rutaceae | Zanthoxylum nitidum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| - | - | Taddalia asiatica | Ref. |
|
|
zoom in
| Organism | Zanthoxylum simulans | | Reference | Ishii, et al., J of Pharm Society(Japan), 111, (1991), 365.
Ishii, et al., J of Pharm Society(Japan), 104, (1984), 1030.
Gray, et al., Planta Med, 39, (1980), 209 |
|---|
|