| Name |
Macranthoin G Macroantoin G 3,5-Dicaffeoylquinic methyl ester (-)-3,5-Dicaffeoylquinic methyl ester |
| Formula |
C26H26O12 |
| Mw |
530.1424263 |
| CAS RN |
159934-13-1 |
| C_ID |
C00043178
, 
|
| InChIKey |
VEBNYMXKXIIGFX-BYRPEJONNA-N |
| InChICode |
InChI=1S/C26H26O12/c1-36-25(34)26(35)12-20(37-22(31)8-4-14-2-6-16(27)18(29)10-14)24(33)21(13-26)38-23(32)9-5-15-3-7-17(28)19(30)11-15/h2-11,20-21,24,27-30,33,35H,12-13H2,1H3/b8-4+,9-5+/t20-,21-,24-,26-/m1/s1 |
| SMILES |
COC(=O)[C@]1(O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera macranthoides  | Ref. |
| Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
| Plantae | Asteraceae | Ageratina adenophora  | Ref. |
|
|
zoom in
| Organism | Ageratina adenophora | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|