| Name |
Nigrolineabiphenyl B |
| Formula |
C15H16O5 |
| Mw |
276.09977362 |
| CAS RN |
864516-28-9 |
| C_ID |
C00042769
, 
|
| InChIKey |
KOOASJSFQKPUPR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H16O5/c1-18-12-6-9(4-5-11(12)16)10-7-13(19-2)15(17)14(8-10)20-3/h4-8,16-17H,1-3H3 |
| SMILES |
COc1cc(-c2cc(OC)c(O)c(OC)c2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia fucsa | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nigrolineata  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
|
|
zoom in
| Organism | Garcinia schomburgkiana | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|