| Name |
Dehydroabietic acid |
| Formula |
C20H28O2 |
| Mw |
300.20893014 |
| CAS RN |
1740-19-8 |
| C_ID |
C00042455
, 
|
| InChIKey |
NFWKVWVWBFBAOV-NQDYJFDNNA-N |
| InChICode |
InChI=1S/C20H28O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h6,8,12-13,17H,5,7,9-11H2,1-4H3,(H,21,22)/t17-,19-,20-/m1/s1 |
| SMILES |
CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Commiphora myrrha  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Lamiaceae | Rabdosia nervosa | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea glehni | Ref. |
| Plantae | Pinaceae | Picea glehnii L. | Ref. |
| Plantae | Pinaceae | Picea koraiensis | Ref. |
| Plantae | Pinaceae | Pinus luchuensis | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| - | - | Sitka spruce | Ref. |
|
|
zoom in
| Organism | Rabdosia nervosa | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001). |
|---|
|