| Name |
7-Hydroxy-4-methoxy-5-methylcoumarin 7-hydroxy-4-methoxy-5-methyl-2H-1-Benzopyran-2-one |
| Formula |
C11H10O4 |
| Mw |
206.05790881 |
| CAS RN |
41680-12-0 |
| C_ID |
C00042174
, 
|
| InChIKey |
UMLNUFLSRYJZFA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H10O4/c1-6-3-7(12)4-9-11(6)8(14-2)5-10(13)15-9/h3-5,12H,1-2H3 |
| SMILES |
COc1cc(=O)oc2cc(O)cc(C)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Davidiellaceae | Cladosporium herbarum IFB-E002 | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe turkanensis | Ref. |
|
|
zoom in
| Organism | Aloe turkanensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|