| Name |
Voachalotine |
| Formula |
C22H26N2O3 |
| Mw |
366.19434271 |
| CAS RN |
664-25-5 |
| C_ID |
C00040643
, 
|
| InChIKey |
IWEYXWIPVZEVPT-HTZZGTHNNA-N |
| InChICode |
InChI=1S/C22H26N2O3/c1-4-13-11-24-18-10-16(13)22(12-25,21(26)27-3)19(24)9-15-14-7-5-6-8-17(14)23(2)20(15)18/h4-8,16,18-19,25H,9-12H2,1-3H3/b13-4-/t16-,18-,19-,22+/m0/s1 |
| SMILES |
C/C=C1/C[N@@]2C3CC1[C@@](CO)(C(=O)OC)[C@@H]2Cc1c3n(C)c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Ervatamia officinalis  | Ref. |
| Plantae | Apocynaceae | Ochrosia acuminata | Ref. |
| Plantae | Apocynaceae | Tabernaemontana heyneana  | Ref. |
| Plantae | Apocynaceae | Voacanga chalotiana Pierre et Stapf. | Ref. |
|
|
zoom in
| Organism | Tabernaemontana heyneana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|