| Name |
Norstictic acid |
| Formula |
C18H12O9 |
| Mw |
372.04813198 |
| CAS RN |
571-67-5 |
| C_ID |
C00039870
, 
|
| InChIKey |
IEVVSJFLBYOUCJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H12O9/c1-5-3-8(20)7(4-19)14-9(5)16(22)26-13-6(2)12(21)10-11(15(13)25-14)18(24)27-17(10)23/h3-4,18,20-21,24H,1-2H3/t18-/m1/s1 |
| SMILES |
Cc1cc(O)c(C=O)c2c1C(=O)Oc1c(C)c(O)c3c(c1O2)C(O)OC3=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Cladoniaceae | Cladonia verticillata | Ref. |
| Fungi | Parmeliaceae | Usnea articulata  | Ref. |
| - | - | Lethariella cladonioides | Ref. |
|
|
zoom in
| Organism | Lethariella cladonioides |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
