| Name |
1-O-Galloyl-beta-D-glucose (-)-1-O-Galloyl-beta-D-glucose |
| Formula |
C13H16O10 |
| Mw |
332.07434673 |
| CAS RN |
13405-60-2 |
| C_ID |
C00038195
, 
|
| InChIKey |
GDVRUDXLQBVIKP-XPPLCHQHNA-N |
| InChICode |
InChI=1S/C13H16O10/c14-3-7-9(18)10(19)11(20)13(22-7)23-12(21)4-1-5(15)8(17)6(16)2-4/h1-2,7,9-11,13-20H,3H2/t7-,9-,10+,11-,13+/m1/s1 |
| SMILES |
O=C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Polygonaceae | Rheum officinal | Ref. |
| Plantae | Polygonaceae | Rheum officinale  | Ref. |
| Plantae | Sapindaceae | Acer rubrum L.  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Phyllanthus emblica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|