| Name |
Paulownin (+)-Paulownin |
| Formula |
C20H18O7 |
| Mw |
370.10525293 |
| CAS RN |
13040-46-5 |
| C_ID |
C00037601
, 
|
| InChIKey |
CAQZFLPWHBKTTR-XLEPQYFWNA-N |
| InChICode |
InChI=1S/C20H18O7/c21-20-8-23-18(11-1-3-14-16(5-11)26-9-24-14)13(20)7-22-19(20)12-2-4-15-17(6-12)27-10-25-15/h1-6,13,18-19,21H,7-10H2/t13-,18-,19-,20-/m1/s1 |
| SMILES |
O[C@]12CO[C@H](c3ccc4c(c3)OCO4)[C@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Dolichandrone stipulata  | Ref. |
| Plantae | Bignoniaceae | Markhamia stipulata  | Ref. |
| Plantae | Labiatae | Gmelina arborea  | Ref. |
| Plantae | Malvaceae | Firmiana platanifolia | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
|
|
zoom in
| Organism | Gmelina arborea | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|