| Name |
Miltirone |
| Formula |
C19H22O2 |
| Mw |
282.16197995 |
| CAS RN |
27210-57-7 |
| C_ID |
C00037506
, 
|
| InChIKey |
FEFAIBOZOKSLJR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H22O2/c1-11(2)14-10-12-7-8-15-13(6-5-9-19(15,3)4)16(12)18(21)17(14)20/h7-8,10-11H,5-6,9H2,1-4H3 |
| SMILES |
CC(C)C1=Cc2ccc3c(c2C(=O)C1=O)CCCC3(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia drobovii | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| - | - | Chinese sage | Ref. |
| - | - | Chinese sage, | Ref. |
|
|
zoom in
| Organism | Salvia miltiorrhiza | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., Planta Med, 55, (1989), 390.
Chem Abstr, 115, (1991), 150185w |
|---|
|