| Name |
Kamolonol |
| Formula |
C24H30O5 |
| Mw |
398.20932407 |
| CAS RN |
94898-76-7 |
| C_ID |
C00037365
, 
|
| InChIKey |
XYUJBOZUFFMPGO-MQZWOPIGNA-N |
| InChICode |
InChI=1S/C24H30O5/c1-14-11-21(26)24(4)15(2)18(25)8-9-20(24)23(14,3)13-28-17-7-5-16-6-10-22(27)29-19(16)12-17/h5-7,10,12,14-15,20-21,26H,8-9,11,13H2,1-4H3/t14-,15+,20+,21-,23-,24+/m1/s1 |
| SMILES |
C[C@@H]1C[C@@H](O)[C@]2(C)[C@@H](C)C(=O)CC[C@H]2[C@]1(C)COc1ccc2ccc(=O)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ferula asafoetida | Ref. |
| Plantae | Apiaceae | Ferula assa-foetida  | Ref. |
| Plantae | Apiaceae | Ferula assafoetida  | Ref. |
|
|
zoom in
| Organism | Ferula assafoetida | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|