| Name |
Amurensin K (+)-Amurensin K |
| Formula |
C56H40O13 |
| Mw |
920.24689137 |
| CAS RN |
388121-56-0 |
| C_ID |
C00036719
, 
|
| InChIKey |
KYCWATKXJOSHQR-OUZCEPSNNA-N |
| InChICode |
InChI=1S/C56H40O13/c57-30-8-1-25(2-9-30)47-49(38-20-36(63)22-45-51(38)53(39-19-35(62)21-42(65)50(39)47)55(68-45)27-5-12-32(59)13-6-27)37-17-28(7-14-41(37)64)44-23-40-52-46(24-43(66)56(40)67-44)69-54(26-3-10-31(58)11-4-26)48(52)29-15-33(60)18-34(61)16-29/h1-24,47-49,53-55,57-66H/t47-,48+,49+,53+,54-,55-/m1/s1 |
| SMILES |
Oc1ccc([C@H]2c3c(O)cc(O)cc3[C@H]3c4c(cc(O)cc4[C@@H]2c2cc(-c4cc5c6c(cc(O)c5o4)O[C@H](c4ccc(O)cc4)[C@H]6c4cc(O)cc(O)c4)ccc2O)O[C@@H]3c2ccc(O)cc2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis (Rupr.) | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis thunbergii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|