| Name |
20-Hydroxyecdysone-20,22-monoacetonide (+)-20-Hydroxyecdysone-20,22-monoacetonide |
| Formula |
C30H48O7 |
| Mw |
520.34000389 |
| CAS RN |
22798-96-5 |
| C_ID |
C00036469
, 
|
| InChIKey |
GXNNYSDWRVKVJY-OETAUHTENA-N |
| InChICode |
InChI=1S/C30H48O7/c1-25(2,34)11-10-24-29(7,37-26(3,4)36-24)23-9-13-30(35)18-14-20(31)19-15-21(32)22(33)16-27(19,5)17(18)8-12-28(23,30)6/h14,17,19,21-24,32-35H,8-13,15-16H2,1-7H3/t17-,19-,21+,22-,23-,24+,27+,28+,29+,30+/m0/s1 |
| SMILES |
CC(C)(O)CC[C@H]1OC(C)(C)O[C@]1(C)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Serratula strangulata  | Ref. |
| Plantae | Malvaceae | Sida spinosa  | Ref. |
|
|
zoom in
| Organism | Sida spinosa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|