| Name |
10-Acetoxymajoroside |
| Formula |
C19H26O12 |
| Mw |
446.1424263 |
| CAS RN |
259753-11-2 |
| C_ID |
C00036395
, 
|
| InChIKey |
ORQJUPOBILPJRX-JHZVMKSUNA-N |
| InChICode |
InChI=1S/C19H26O12/c1-7(21)28-6-10-11(22)3-8-9(17(26)27-2)5-29-18(13(8)10)31-19-16(25)15(24)14(23)12(4-20)30-19/h5,8,11-12,14-16,18-20,22-25H,3-4,6H2,1-2H3/t8-,11+,12-,14-,15+,16-,18+,19+/m1/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C2=C(COC(C)=O)[C@@H](O)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Plantago cornuti | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
|
|
zoom in
| Organism | Veronica cymbalaria |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
