| Name |
(+)-Vitisifuran A |
| Formula |
C56H40O12 |
| Mw |
904.25197674 |
| CAS RN |
223591-28-4 |
| C_ID |
C00036321
, 
|
| InChIKey |
OTYIKSOKCAQFIS-XLAQHMHFNA-N |
| InChICode |
InChI=1S/C56H40O12/c57-33-10-4-28(5-11-33)49-51(42-23-40(64)26-47-53(42)54(43-22-39(63)24-45(66)52(43)49)56(68-47)30-8-14-35(59)15-9-30)41-17-27(2-16-44(41)65)1-3-31-18-38(62)25-46-48(31)50(32-19-36(60)21-37(61)20-32)55(67-46)29-6-12-34(58)13-7-29/h1-26,49,51,54,56-66H/b3-1+/t49-,51-,54-,56+/m0/s1 |
| SMILES |
Oc1ccc(-c2oc3cc(O)cc(/C=C/c4ccc(O)c([C@H]5c6cc(O)cc7c6[C@H](c6cc(O)cc(O)c6C5c5ccc(O)cc5)[C@@H](c5ccc(O)cc5)O7)c4)c3c2-c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis (Rupr.) | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis thunbergii |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
