| Name |
O-Methylpisiferic acid |
| Formula |
C21H30O3 |
| Mw |
330.21949482 |
| CAS RN |
76235-94-4 |
| C_ID |
C00036186
, 
|
| InChIKey |
JIBLKUQZATYEIK-PUUMMNGONA-N |
| InChICode |
InChI=1S/C21H30O3/c1-13(2)15-11-14-7-8-18-20(3,4)9-6-10-21(18,19(22)23)16(14)12-17(15)24-5/h11-13,18H,6-10H2,1-5H3,(H,22,23)/t18-,21-/m0/s1 |
| SMILES |
COc1cc2c(cc1C(C)C)CC[C@H]1C(C)(C)CCC[C@]21C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Labiatae | Salvia blepharochaena Hedge and Hub.Mor. | Ref. |
| Plantae | Labiatae | Salvia blepharochlaena | Ref. |
|
|
zoom in
| Organism | Salvia blepharochaena Hedge and Hub.Mor. | | Reference | Ulubelen,Phytochem.,64,(2003),395 |
|---|
|