| Name |
Moracin D 7-(6-Hydroxy-2-benzofuranyl)-2,2-dimethyl-2H-1-benzopyran-5-ol |
| Formula |
C19H16O4 |
| Mw |
308.104859 |
| CAS RN |
69120-07-6 |
| C_ID |
C00036150
, 
|
| InChIKey |
CHAAQDMHLLQJRO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H16O4/c1-19(2)6-5-14-15(21)7-12(9-18(14)23-19)16-8-11-3-4-13(20)10-17(11)22-16/h3-10,20-21H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(O)cc(-c3cc4ccc(O)cc4o3)cc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Nectriaceae | Fusarium solani | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus sp. | Ref. |
|
|
zoom in
| Organism | Morus alba | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Lee, et al., Journal of Natural Products, 64, (2001), 1286 |
|---|
|