| Name |
7-Acetylhorminone 7alpha-Acetoxyroyleanone |
| Formula |
C22H30O5 |
| Mw |
374.20932407 |
| CAS RN |
6812-88-0 |
| C_ID |
C00036020
, 
|
| InChIKey |
XDBVTCDGDQLEKG-WJQPSFEGNA-N |
| InChICode |
InChI=1S/C22H30O5/c1-11(2)15-18(24)16-13(27-12(3)23)10-14-21(4,5)8-7-9-22(14,6)17(16)20(26)19(15)25/h11,13-14,25H,7-10H2,1-6H3/t13-,14+,22+/m1/s1 |
| SMILES |
CC(=O)O[C@@H]1C[C@H]2C(C)(C)CCC[C@]2(C)C2=C1C(=O)C(C(C)C)=C(O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
| Plantae | Labiatae | Salvia austriaca | Ref. |
| Plantae | Labiatae | Salvia blepharochaena Hedge and Hub. Mor. | Ref. |
| Plantae | Labiatae | Salvia blepharochlaena | Ref. |
| Plantae | Labiatae | Salvia bracteata Banks and Sol. | Ref. |
| Plantae | Labiatae | Salvia eriophora Boiss and Kotschy | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Salvia verticillata | Ref. |
| Plantae | Lamiaceae | Coleus carnosus | Ref. |
|
|
zoom in
| Organism | Salvia blepharochaena Hedge and Hub. Mor. | | Reference | Ulubelen,Phytochem.,64,(2003),395 |
|---|
|