| Name |
beta-Funebrene (-)-beta-Funebrene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
79120-98-2 |
| C_ID |
C00035811
, 
|
| InChIKey |
DYLPEFGBWGEFBB-LQNFGWCTNA-N |
| InChICode |
InChI=1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+,15-/m1/s1 |
| SMILES |
C=C1CC[C@]23C[C@H]1C(C)(C)[C@@H]2CC[C@H]3C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|