| Name |
Arjungenin (+)-Arjungenin |
| Formula |
C30H48O6 |
| Mw |
504.34508927 |
| CAS RN |
58880-25-4 |
| C_ID |
C00035051
, 
|
| InChIKey |
IFIQVSCCFRXSJV-JGNBAJADNA-N |
| InChICode |
InChI=1S/C30H48O6/c1-25(2)11-13-30(24(35)36)14-12-28(5)17(21(30)23(25)34)7-8-20-26(3)15-18(32)22(33)27(4,16-31)19(26)9-10-29(20,28)6/h7,18-23,31-34H,8-16H2,1-6H3,(H,35,36)/t18-,19-,20-,21-,22+,23+,26+,27+,28-,29-,30+/m1/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Combretaceae | Pteleopsis suberosa Engl.et Diels  | Ref. |
| Plantae | Combretaceae | Terminalia arjuna  | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
|
|
zoom in
| Organism | Terminalia arjuna | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|