| Name |
8-Feruloylharpagide 8-O-Feruloylhapagide 8-O-Feruloylharpagide |
| Formula |
C25H32O13 |
| Mw |
540.18429111 |
| CAS RN |
221003-20-9 |
| C_ID |
C00035034
, 
|
| InChIKey |
XEAHABRMMIVTAK-WUGQCQPBNA-N |
| InChICode |
InChI=1S/C25H32O13/c1-24(38-17(29)6-4-12-3-5-13(27)14(9-12)34-2)10-16(28)25(33)7-8-35-23(21(24)25)37-22-20(32)19(31)18(30)15(11-26)36-22/h3-9,15-16,18-23,26-28,30-33H,10-11H2,1-2H3/b6-4+/t15-,16-,18-,19+,20-,21-,22+,23+,24+,25+/m1/s1 |
| SMILES |
COc1cc(/C=C/C(=O)O[C@@]2(C)C[C@@H](O)[C@]3(O)C=CO[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H]32)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pedaliaceae | Harpagophytum procumbens  | Ref. |
| Plantae | Pedaliaceae | Harpagophytum prucumbens D.C. | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|