| Name |
Scropolioside D Scrospioside A |
| Formula |
C34H42O17 |
| Mw |
722.24219992 |
| CAS RN |
148000-43-5 |
| C_ID |
C00034977
, 
|
| InChIKey |
XTDOKCBBQODVJW-MDZDMXLPNA-N |
| InChICode |
InChI=1S/C34H42O17/c1-15-26(45-16(2)37)28(48-21(39)10-9-18-7-5-4-6-8-18)29(46-17(3)38)33(44-15)49-27-19-11-12-43-31(22(19)34(14-36)30(27)51-34)50-32-25(42)24(41)23(40)20(13-35)47-32/h4-12,15,19-20,22-33,35-36,40-42H,13-14H2,1-3H3/b10-9+/t15-,19+,20-,22+,23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34-/m1/s1 |
| SMILES |
CC(=O)OC1C(C)OC(OC2C3C=COC(OC4OC(CO)C(O)C(O)C4O)C3C3(CO)OC23)C(OC(C)=O)C1OC(=O)/C=C/c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia deserti  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ilwensis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia oxysepala | Ref. |
|
|
zoom in
| Organism | Scrophularia ilwensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|