| Name |
Madagascin |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
14228-13-8 |
| C_ID |
C00034872
, 
|
| InChIKey |
AIEGEPAELPMAPY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-10(2)4-5-25-12-8-14-18(16(22)9-12)20(24)17-13(19(14)23)6-11(3)7-15(17)21/h4,6-9,21-22H,5H2,1-3H3 |
| SMILES |
CC(C)=CCOc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hypericaceae | Cratoxylum formosum  | Ref. |
| Plantae | Rhamnaceae | Rhamnus cathartica  | Ref. |
| Plantae | Rhamnaceae | Rhamnus intermedia | Ref. |
|
|
zoom in
| Organism | Rhamnus intermedia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|