| Name |
Amphicoside |
| Formula |
C23H28O13 |
| Mw |
512.15299098 |
| CAS RN |
34779-62-9 |
| C_ID |
C00034409
, 
|
| InChIKey |
AKNILCMFRRDTEY-ZAKILBIENA-N |
| InChICode |
InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3/t10-,13-,14-,15-,16+,17-,18+,19+,21+,22+,23-/m1/s1 |
| SMILES |
COc1cc(C(=O)O[C@H]2C3C=CO[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C3[C@@]3(CO)O[C@@H]23)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Paederota lutea | Ref. |
| Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
| Plantae | Plantaginaceae | Veronica cuneifolia | Ref. |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
| Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
| Plantae | Plantaginaceae | Veronica kellererii | Ref. |
| Plantae | Plantaginaceae | Veronica pectinata | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica turrilliana | Ref. |
| - | - | Amphicome emodi  | Ref. |
| - | - | Vernoica cymbalaria | Ref. |
|
|
zoom in
| Organism | Veronica cuneifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|