| Name |
(E)-Methyl 4-methoxycinnamate 4-Methoxy-trans-cinnamic acid Methyl (E)-p-methoxycinnamate |
| Formula |
C11H12O3 |
| Mw |
192.07864425 |
| CAS RN |
3901-07-3 |
| C_ID |
C00034395
, 
|
| InChIKey |
VEZIKIAGFYZTCI-VMPITWQZSA-N |
| InChICode |
InChI=1S/C11H12O3/c1-13-10-6-3-9(4-7-10)5-8-11(12)14-2/h3-8H,1-2H3/b8-5+ |
| SMILES |
COC(=O)/C=C/c1ccc(OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Polyporaceae | Daedaleopsis quercina | Ref. |
| Fungi | Polyporaceae | Lentinus lepidus | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Piperaceae | Piper philippinum | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|