| Name |
Arjunglucoside II Arjunoglucoside II (+)-Arjunoglucoside II |
| Formula |
C36H58O10 |
| Mw |
650.40299807 |
| CAS RN |
62369-72-6 |
| C_ID |
C00032736
, 
|
| InChIKey |
CJHYKSSBQRABTM-TWXZUPISNA-N |
| InChICode |
InChI=1S/C36H58O10/c1-31(2)11-13-36(30(44)46-29-27(42)26(41)25(40)22(17-37)45-29)14-12-34(5)19(20(36)15-31)7-8-24-32(3)16-21(39)28(43)33(4,18-38)23(32)9-10-35(24,34)6/h7,20-29,37-43H,8-18H2,1-6H3/t20-,21+,22+,23+,24+,25+,26-,27+,28-,29-,32-,33-,34+,35+,36-/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Combretaceae | Pteleopsis suberosa Engl.et Diels  | Ref. |
| Plantae | Combretaceae | Terminalia arjuna  | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
|
|
zoom in
| Organism | Terminalia arjuna | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|