| Name |
3-Hydroxytyrosol 3,4-Dihydroxyphenethyl alcohol Hydroxytyrosol |
| Formula |
C8H10O3 |
| Mw |
154.06299419 |
| CAS RN |
10597-60-1 |
| C_ID |
C00032635
, 
|
| InChIKey |
JUUBCHWRXWPFFH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 |
| SMILES |
OCCc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Fraxinus americana | Ref. |
| Plantae | Oleaceae | Olea europaea L.  | Ref. |
| Plantae | Oleaceae | Syringa amurensis | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Syringa amurensis | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|