| Name |
Zonarene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
36437-95-3 |
| C_ID |
C00032554
, 
|
| InChIKey |
FIAKMTRUEKZMNO-QSKWDSTQNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,12,14H,5-8H2,1-4H3/t12-,14-/m1/s1 |
| SMILES |
CC1=CC2=C(C(C)C)CC[C@@H](C)[C@H]2CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|