| Name |
Totaradiol 3beta-Hydroxytotarol |
| Formula |
C20H30O2 |
| Mw |
302.2245802 |
| CAS RN |
3772-56-3 |
| C_ID |
C00032365
, 
|
| InChIKey |
NORGIWDZGWMMGU-KNQOLKPNNA-N |
| InChICode |
InChI=1S/C20H30O2/c1-12(2)18-13-6-9-16-19(3,4)17(22)10-11-20(16,5)14(13)7-8-15(18)21/h7-8,12,16-17,21-22H,6,9-11H2,1-5H3/t16-,17-,20+/m0/s1 |
| SMILES |
CC(C)c1c(O)ccc2c1CC[C@H]1C(C)(C)[C@@H](O)CC[C@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Platycladus orientalis  | Ref. |
| Plantae | Myricaceae | Myrica nagi  | Ref. |
| Plantae | Podocarpaceae | Podocarpus macrophyllus D.DON  | Ref. |
|
|
zoom in
| Organism | Myrica nagi | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|