| Name |
Strictosamide |
| Formula |
C26H30N2O8 |
| Mw |
498.20021595 |
| CAS RN |
23141-25-5 |
| C_ID |
C00032210
, 
|
| InChIKey |
LBRPLJCNRZUXLS-DAZQAGIPNA-N |
| InChICode |
InChI=1S/C26H30N2O8/c1-2-12-15-9-18-20-14(13-5-3-4-6-17(13)27-20)7-8-28(18)24(33)16(15)11-34-25(12)36-26-23(32)22(31)21(30)19(10-29)35-26/h2-6,11-12,15,18-19,21-23,25-27,29-32H,1,7-10H2/t12-,15-,18-,19+,21+,22-,23+,25-,26-/m0/s1 |
| SMILES |
C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C2C(=O)N3CCc4c([nH]c5ccccc45)[C@@H]3C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Ochrosia acuminata | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Gelsemiaceae | Mostuea brunnonis | Ref. |
| Plantae | Gelsemiaceae | Mostuea brunonis Didr. | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Nauclea latifolia  | Ref. |
| Plantae | Rubiaceae | Nauclea orientalis  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza pumila | Ref. |
| Plantae | Rubiaceae | Palicourea acuminata | Ref. |
| Plantae | Rubiaceae | Palicourea tsakiana | Ref. |
| Plantae | Rubiaceae | Palicourea winkleri | Ref. |
| Plantae | Rubiaceae | Psychotria bahiensis | Ref. |
| Plantae | Rubiaceae | Psychotria myriantha | Ref. |
| Plantae | Rubiaceae | Psychotria nuda | Ref. |
| Plantae | Rubiaceae | Psychotria suterella | Ref. |
| Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|