| Name |
Matairesinoside (-)-Matairesinoside |
| Formula |
C26H32O11 |
| Mw |
520.19446187 |
| CAS RN |
23202-85-9 |
| C_ID |
C00032004
, 
|
| InChIKey |
AAGCATAPYOEULE-IWRZJUISNA-N |
| InChICode |
InChI=1S/C26H32O11/c1-33-19-9-13(3-5-17(19)28)7-15-12-35-25(32)16(15)8-14-4-6-18(20(10-14)34-2)36-26-24(31)23(30)22(29)21(11-27)37-26/h3-6,9-10,15-16,21-24,26-31H,7-8,11-12H2,1-2H3/t15-,16+,21+,22+,23-,24+,26+/m0/s1 |
| SMILES |
COc1cc(C[C@H]2COC(=O)[C@@H]2Cc2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)c2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea americana | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Oleaceae | Forsythia viridissima | Ref. |
| Plantae | Styracaceae | Styrax japonica S.et Z. | Ref. |
| Plantae | Symplocaceae | Symplocos caudata Wall | Ref. |
| Plantae | Thymelaeaceae | Daphne feddei | Ref. |
|
|
zoom in
| Organism | Forsythia viridissima | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kim, et al., Chem Pharm Bull, 52, (2004), 1466 |
|---|
|