| Name |
Kadsuric acid |
| Formula |
C30H46O4 |
| Mw |
470.33960996 |
| CAS RN |
62393-88-8 |
| C_ID |
C00031951
, 
|
| InChIKey |
JGNPDWQZTUZFHK-JUNNUSKHNA-N |
| InChICode |
InChI=1S/C30H46O4/c1-19(2)22-11-12-25-24(28(22,5)16-15-26(31)32)14-18-29(6)23(13-17-30(25,29)7)20(3)9-8-10-21(4)27(33)34/h10,14,20,22-23,25H,1,8-9,11-13,15-18H2,2-7H3,(H,31,32)(H,33,34)/b21-10-/t20-,22+,23-,25-,28+,29-,30+/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@@H]2C(=CC[C@]3(C)[C@@H]([C@H](C)CC/C=C(/C)C(=O)O)CC[C@@]23C)[C@@]1(C)CCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Schisandraceae | Kadsura coccinea | Ref. |
| Plantae | Schisandraceae | Kadsura japonica  | Ref. |
| Plantae | Schisandraceae | Schisandra henryi | Ref. |
| Plantae | Schisandraceae | Schisandra micrantha | Ref. |
|
|
zoom in
| Organism | Schisandra henryi |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Zhou, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 38, (2003), 81.
LI, et al., Chem Pharm Bull, 51, (2003), 1174 |
|---|
|
