| Name |
Ixocarpalactone A |
| Formula |
C28H40O8 |
| Mw |
504.27231825 |
| CAS RN |
71801-45-1 |
| C_ID |
C00031918
, 
|
| InChIKey |
PHBPDHFIJFLEGD-XOEHZKBCNA-N |
| InChICode |
InChI=1S/C28H40O8/c1-12-13(2)24(33)35-21(12)23(32)27(5,34)22-17(29)11-16-14-10-20-28(36-20)19(31)7-6-18(30)26(28,4)15(14)8-9-25(16,22)3/h6-7,12-17,19-23,29,31-32,34H,8-11H2,1-5H3/t12-,13-,14-,15+,16+,17+,19+,20-,21-,22+,23-,25+,26+,27-,28-/m1/s1 |
| SMILES |
C[C@H]1[C@H]([C@@H](O)[C@](C)(O)[C@H]2[C@@H](O)CC3[C@@H]4C[C@H]5O[C@]56[C@@H](O)C=CC(=O)[C@]6(C)C4CC[C@@]32C)OC(=O)[C@@H]1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Physalis ixocarpa  | Ref. |
| Plantae | Solanaceae | Physalis philadelphica  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
|
|
zoom in
| Organism | Withania somnifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|