| Name |
Apigenin 7-O-beta-D-(6-O-p-coumaroyl)glucopyranoside Apigenin 7-O-[6-O-p-(Z)-coumaroyl]-.beta.-D-glucopyranoside Z-Echinacin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
933463-04-8 |
| C_ID |
C00031603
, 
|
| InChIKey |
OXNLOFAZIKHOII-RIFWKBDYNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-17-6-1-15(2-7-17)3-8-19(33)14-39-29-27(37)26(36)28(38)30(42-29)40-20-11-21(34)25-22(35)13-23(41-24(25)12-20)16-4-9-18(32)10-5-16/h1-13,26-32,34,36-38H,14H2/b8-3-/t26-,27-,28+,29-,30+/m0/s1 |
| SMILES |
O=C(/C=Cc1ccc(O)cc1)CO[C@H]1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Leucas cephalotes SPRENG.  | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|