| Name |
Rubiadin-1-methyl ether |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
7460-43-7 |
| C_ID |
C00031233
, 
|
| InChIKey |
NTBUBTCXACOEEC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-8-12(17)7-11-13(16(8)20-2)15(19)10-6-4-3-5-9(10)14(11)18/h3-7,17H,1-2H3 |
| SMILES |
COc1c(C)c(O)cc2c1C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Hymenodictyon excelsum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia L.  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Neonauclea calycina | Ref. |
|
|
zoom in
| Organism | Morinda officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|