| Name |
Rostratamine |
| Formula |
C27H35NO7 |
| Mw |
485.24135248 |
| CAS RN |
50299-46-2 |
| C_ID |
C00031197
, 
|
| InChIKey |
GQDQWQRPCUUAFD-ORIVAHKZNA-N |
| InChICode |
InChI=1S/C27H35NO7/c1-16(29)25(32)10-11-27(34)24(25,3)21(35-22(31)17-5-4-12-28-15-17)14-20-23(2)8-7-19(30)13-18(23)6-9-26(20,27)33/h4-6,12,15,19-21,30,32-34H,7-11,13-14H2,1-3H3/t19-,20+,21+,23-,24+,25+,26-,27+/m0/s1 |
| SMILES |
CC(=O)[C@]1(O)CC[C@@]2(O)[C@]1(C)[C@H](OC(=O)c1cccnc1)C[C@@H]1[C@@]3(C)CC[C@H](O)CC3=CC[C@]12O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Araujia sericifera | Ref. |
| Plantae | Apocynaceae | Cynanchum otophyllum | Ref. |
| Plantae | Apocynaceae | Cynanchum wallichii | Ref. |
| Plantae | Apocynaceae | Marsdenia rostrata | Ref. |
|
|
zoom in
| Organism | Cynanchum wallichii | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|