| Name |
Panaxytriol |
| Formula |
C17H26O3 |
| Mw |
278.1881947 |
| CAS RN |
87005-03-6 |
| C_ID |
C00030923
, 
|
| InChIKey |
RDIMTXDFGHNINN-PATXDTRCNA-N |
| InChICode |
InChI=1S/C17H26O3/c1-3-5-6-7-10-13-16(19)17(20)14-11-8-9-12-15(18)4-2/h4,15-20H,2-3,5-7,10,13-14H2,1H3/t15-,16-,17-/m1/s1 |
| SMILES |
C=C[C@@H](O)C#CC#CC[C@@H](O)[C@H](O)CCCCCCC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax notoginseng | Ref. |
| Plantae | Araliaceae | Panax pseudo-ginseng var.notoginseng | Ref. |
|
|
zoom in
| Organism | Panax pseudo-ginseng var.notoginseng |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|
